Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Olopatadine hydrochloride is a dual acting histamine H1-receptor antagonist and mast cell stabilizer | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10671 |
|---|---|
| Formula | C21H23NO3.HCl |
| Molecular Weight | 373.87 |
| CAS Number | 140462-76-6 |
| SMILES | CN(C)CC/C=C\1/C2=CC=CC=C2COC3=C1C=C(C=C3)CC(=O)O.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 69 mg/mL (184.55 mM) | |
| Water | 12 mg/mL (32.1 mM) | ||
| Ethanol | 7 mg/mL (18.72 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.75 mL | 133.74 mL | 267.47 mL |
| 0.5 mM | 5.35 mL | 26.75 mL | 53.49 mL |
| 1 mM | 2.67 mL | 13.37 mL | 26.75 mL |
| 5 mM | 0.53 mL | 2.67 mL | 5.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
