Signaling Pathway
PF-3845 is a potent, selective, and irreversible inhibitor of FAAH (Ki = 0.23 μM). It reduces inflammatory pain via a cannabinoid receptor-dependent mechanism.
Important Notice: For research use only. We do not sell to patients.
| Discription | PF-3845 is a potent, selective, and irreversible inhibitor of FAAH (Ki = 0.23 μM). It reduces inflammatory pain via a cannabinoid receptor-dependent mechanism. |
||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11183 |
|---|---|
| Formula | C24H23F3N4O2 |
| Molecular Weight | 456.46 |
| CAS Number | 1196109-52-0 |
| SMILES | C1CN(CCC1CC2=CC(=CC=C2)OC3=NC=C(C=C3)C(F)(F)F)C(=O)NC4=CN=CC=C4 |
| Synonyms | PF3845 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 87 mg/mL (190.6 mM) | |
| Water | Insoluble | ||
| Ethanol | 87 mg/mL (190.6 mM) | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 14 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.91 mL | 109.54 mL | 219.08 mL |
| 0.5 mM | 4.38 mL | 21.91 mL | 43.82 mL |
| 1 mM | 2.19 mL | 10.95 mL | 21.91 mL |
| 5 mM | 0.44 mL | 2.19 mL | 4.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
