Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PF 431396 is a dual focal adhesion kinase (FAK) and proline-rich tyrosine kinase 2 (PYK2) inhibitor (IC50 values are 2 and 11 nM respectively). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11142 |
|---|---|
| Formula | C22H21F3N6O3S |
| Molecular Weight | 506.5 |
| CAS Number | 717906-29-1 |
| SMILES | CN(C1=CC=CC=C1CNC2=NC(=NC=C2C(F)(F)F)NC3=CC4=C(C=C3)NC(=O)C4)S(=O)(=O)C |
| Synonyms | PF-431396 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 94 mg/mL (185.58 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.74 mL | 98.72 mL | 197.43 mL |
| 0.5 mM | 3.95 mL | 19.74 mL | 39.49 mL |
| 1 mM | 1.97 mL | 9.87 mL | 19.74 mL |
| 5 mM | 0.39 mL | 1.97 mL | 3.95 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
