Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PF 477736 is a selective checkpoint kinase 1 (Chk1) inhibitor (Ki values are 0.49 and 47 nM for Chk1 and Chk2 respectively). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11520 |
|---|---|
| Formula | C22H25N7O2 |
| Molecular Weight | 419.48 |
| CAS Number | 952021-60-2 |
| SMILES | CN1C=C(C=N1)C2=NC3=C4C2=CNNC(=O)C4=CC(=C3)NC(=O)[C@@H](C5CCCCC5)N |
| Synonyms | PF-0044736, PF0044736 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 5 mg/mL (11.92 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+40% PEG 300 | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.84 mL | 119.2 mL | 238.39 mL |
| 0.5 mM | 4.77 mL | 23.84 mL | 47.68 mL |
| 1 mM | 2.38 mL | 11.92 mL | 23.84 mL |
| 5 mM | 0.48 mL | 2.38 mL | 4.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
