Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Phenformin hydrochloride is a hydrochloride salt of phenformin from the biguanide drug class that displays anti-diabetic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10717 |
|---|---|
| Formula | C10H15N5.HCl;C10H16ClN5 |
| Molecular Weight | 241.72 |
| CAS Number | 834-28-6 |
| SMILES | C1=CC=C(C=C1)CCN=C(N)N=C(N)N.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL (177.89 mM) | |
| Water | 43 mg/mL (177.89 mM) | ||
| Ethanol | 11 mg/mL (45.5 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.37 mL | 206.85 mL | 413.7 mL |
| 0.5 mM | 8.27 mL | 41.37 mL | 82.74 mL |
| 1 mM | 4.14 mL | 20.69 mL | 41.37 mL |
| 5 mM | 0.83 mL | 4.14 mL | 8.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
