Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PIK-75 is an imidazopyridine that selectively inhibits p110α with an IC50 value of 5.8 nM.2 It inhibits p110γ and p110β considerably less effectively with IC50 values of 0.076 μM and 1.3 μM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10729 |
|---|---|
| Formula | C16H14BrN5O4S.HCl |
| Molecular Weight | 488.7 |
| CAS Number | 372196-77-5 |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)N(C)/N=C/C2=CN=C3N2C=C(C=C3)Br.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 4 mg/mL (8.18 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.46 mL | 102.31 mL | 204.62 mL |
| 0.5 mM | 4.09 mL | 20.46 mL | 40.92 mL |
| 1 mM | 2.05 mL | 10.23 mL | 20.46 mL |
| 5 mM | 0.41 mL | 2.05 mL | 4.09 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
