Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PIK-90 is a synthetic phosphoinositide 3-kinase (PI3K) inhibitor with IC50 values (nM) of 11, 350, 18, and 58 for p110 α, β, γ and δ isoforms, low mTOR activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10730 |
|---|---|
| Formula | C18H17N5O3 |
| Molecular Weight | 351.4 |
| CAS Number | 677338-12-4 |
| SMILES | COC1=C(C2=C(C=C1)C3=NCCN3C(=N2)NC(=O)C4=CN=CC=C4)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 0.27 mg/mL (0.76 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80, pH 4 | 14 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.46 mL | 142.29 mL | 284.58 mL |
| 0.5 mM | 5.69 mL | 28.46 mL | 56.92 mL |
| 1 mM | 2.85 mL | 14.23 mL | 28.46 mL |
| 5 mM | 0.57 mL | 2.85 mL | 5.69 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
