Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PIK 93 selectively inhibits the type III PI 4-kinase enzyme, and small interfering RNA-mediated down-regulation of the individual PI 4-kinase enzymes. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10731 |
|---|---|
| Formula | C14H16ClN3O4S2 |
| Molecular Weight | 389.9 |
| CAS Number | 593960-11-3 |
| SMILES | CC1=C(SC(=N1)NC(=O)C)C2=CC(=C(C=C2)Cl)S(=O)(=O)NCCO |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 69 mg/mL (176.98 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.65 mL | 128.24 mL | 256.48 mL |
| 0.5 mM | 5.13 mL | 25.65 mL | 51.3 mL |
| 1 mM | 2.56 mL | 12.82 mL | 25.65 mL |
| 5 mM | 0.51 mL | 2.56 mL | 5.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
