Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PKI-402 is a dual phosphatidylinositol 3-kinase/mammalian target of rapamycin inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11089 |
|---|---|
| Formula | C29H34N10O3 |
| Molecular Weight | 570.7 |
| CAS Number | 1173204-81-3 |
| SMILES | CCN1C2=C(C(=NC(=N2)C3=CC=C(C=C3)NC(=O)NC4=CC=C(C=C4)C(=O)N5CCN(CC5)C)N6CCOCC6)N=N1 |
| Synonyms | PKI402 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 0.35 mg/mL (0.61 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.52 mL | 87.61 mL | 175.22 mL |
| 0.5 mM | 3.5 mL | 17.52 mL | 35.04 mL |
| 1 mM | 1.75 mL | 8.76 mL | 17.52 mL |
| 5 mM | 0.35 mL | 1.75 mL | 3.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
