Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | The activity of Pluripotin (SC-1) is mediated by the combined inhibition of RasGAP and ERK1 with Kd values of 98 and 212 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11225 |
|---|---|
| Formula | C27H25F3N8O2 |
| Molecular Weight | 550.5 |
| CAS Number | 839707-37-8 |
| SMILES | Cc1nn(C)c(Nc2ncc3CN(c4cc(ccc4C)NC(=O)c4cccc(c4)C(F)(F)F)C(=O)N(C)c3n2)c1 |
| Synonyms | SC-1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 96 mg/mL (174.37 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.17 mL | 90.83 mL | 181.65 mL |
| 0.5 mM | 3.63 mL | 18.17 mL | 36.33 mL |
| 1 mM | 1.82 mL | 9.08 mL | 18.17 mL |
| 5 mM | 0.36 mL | 1.82 mL | 3.63 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
