Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pramipexole dihydrochloride is a dopamine receptor agonist exhibiting selectivity for the D3 receptor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12536 |
|---|---|
| Formula | C10H17N3S.2HCl |
| Molecular Weight | 284.25 |
| CAS Number | 104632-25-9 |
| SMILES | CCCN[C@H]1CCC2=C(C1)SC(=N2)N.Cl.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (175.89 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.18 mL | 175.9 mL | 351.8 mL |
| 0.5 mM | 7.04 mL | 35.18 mL | 70.36 mL |
| 1 mM | 3.52 mL | 17.59 mL | 35.18 mL |
| 5 mM | 0.7 mL | 3.52 mL | 7.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
