Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PSI-6206 is the deaminated derivative of PSI-6130, which is a potent inhibitor of hepatitis C virus (HCV) replication in the subgenomic HCV reolicon system. |
|---|
| Catalog Num | A11530 |
|---|---|
| Formula | C10H13FN2O5 |
| Molecular Weight | 260.22 |
| CAS Number | 863329-66-2 |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)CO)O)F |
| Synonyms | PSI 6206, PSI6206, GS-331007, RO-2433 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 47 mg/mL (180.62 mM) | |
| Water | 47 mg/mL (180.62 mM) | ||
| Ethanol | 22 mg/mL (84.54 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 38.43 mL | 192.15 mL | 384.29 mL |
| 0.5 mM | 7.69 mL | 38.43 mL | 76.86 mL |
| 1 mM | 3.84 mL | 19.21 mL | 38.43 mL |
| 5 mM | 0.77 mL | 3.84 mL | 7.69 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
