Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Purvalanol B is a cyclin-dependent kinase inhibitor. IC50 values are 6, 6, 9, > 10,000, and 6 nM for cdc2/cyclin B, cdk2/cyclin A, cdk2/cyclin E, cdk4/cyclin D1 and cdk5-p35 respectively. Selective over a range of other protein kinases (IC50 > 10,000 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12352 |
|---|---|
| Formula | C20H25ClN6O3 |
| Molecular Weight | 432.91 |
| CAS Number | 212844-54-7 |
| SMILES | CC(C)[C@H](CO)NC1=NC2=C(C(=N1)NC3=CC(=C(C=C3)C(=O)O)Cl)N=CN2C(C)C |
| Synonyms | NG 95 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 84 mg/mL (194.04 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.1 mL | 115.5 mL | 230.99 mL |
| 0.5 mM | 4.62 mL | 23.1 mL | 46.2 mL |
| 1 mM | 2.31 mL | 11.55 mL | 23.1 mL |
| 5 mM | 0.46 mL | 2.31 mL | 4.62 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
