Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SAR131675, a potent and selective VEGFR-3-TK inhibitor with antilymphangiogenic, antitumoral, and antimetastatic activities. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13377 |
|---|---|
| Formula | C18H22N4O4 |
| Molecular Weight | 358.29 |
| CAS Number | 1433953-83-3 |
| SMILES | CCN1C(=C(C(=O)C2=C1N=C(C=C2)C#C[C@](C)(COC)O)C(=O)NC)N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 29 mg/mL (80.91 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+30% PEG 300+5% Tween 80+ddH2O | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.91 mL | 139.55 mL | 279.1 mL |
| 0.5 mM | 5.58 mL | 27.91 mL | 55.82 mL |
| 1 mM | 2.79 mL | 13.96 mL | 27.91 mL |
| 5 mM | 0.56 mL | 2.79 mL | 5.58 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
