Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Syringin is a natural chemical compound first isolated from the bark of lilac (Syringa vulgaris) by Meillet in 1841. |
|---|
| Catalog Num | A12041 |
|---|---|
| Formula | C17H24O9 |
| Molecular Weight | 372.37 |
| CAS Number | 118-34-3 |
| SMILES | COC1=CC(=CC(=C1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)OC)/C=C/CO |
| Synonyms | Ligustrin, Methoxyconiferine, Eleutheroside B |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 69 mg/mL (185.29 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.86 mL | 134.28 mL | 268.55 mL |
| 0.5 mM | 5.37 mL | 26.86 mL | 53.71 mL |
| 1 mM | 2.69 mL | 13.43 mL | 26.86 mL |
| 5 mM | 0.54 mL | 2.69 mL | 5.37 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
