Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TAK 715 an inhibitor of p38 MAPK (IC50 = 7.1 nM for p38 MAPKα), Wnt/beta-catenin signaling, and Inhibits 22 kinases by more than 80%, including CK 1δ/ε. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11582 |
|---|---|
| Formula | C24H21N3OS |
| Molecular Weight | 399.51 |
| CAS Number | 303162-79-0 |
| SMILES | CCC1=NC(=C(S1)C2=CC(=NC=C2)NC(=O)C3=CC=CC=C3)C4=CC(=CC=C4)C |
| Synonyms | TAK715, TAK 715 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 72 mg/mL (180.22 mM) | |
| Water | Insoluble | ||
| Ethanol | 14 mg/mL (35.04 mM) | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.03 mL | 125.15 mL | 250.31 mL |
| 0.5 mM | 5.01 mL | 25.03 mL | 50.06 mL |
| 1 mM | 2.5 mL | 12.52 mL | 25.03 mL |
| 5 mM | 0.5 mL | 2.5 mL | 5.01 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
