Total item
Cart Subtotal
$0.00 Details
TAK-901 is a novel inhibitor of Aurora A/B with IC50 of 21 nM/15 nM. It is not a potent inhibitor of cellular JAK2, c-Src or Abl. Phase 1.
Targets
| Target | Value |
|---|---|
| JAK3 | IC50: 1.2nM |
| c-Src | IC50: 1.3nM |
| CLK2 | IC50: <2.0nM |
| FGR | IC50: <2.0nM |
| YES1 | IC50: <2.0nM |
| LRRK2 | IC50: 3.0nM |
| FLT3 | IC50: 5.0nM |
| Fyn | IC50: 5.3nM |
| ARG | IC50: 5.6nM |
| Axl | IC50: 5.8nM |
| Hck | IC50: 5.8nM |
| SNF1LK2 | IC50: 6.0nM |
| Abl | IC50: 6.4nM |
| RET | IC50: 6.5nM |
| TrkA | IC50: 6.7nM |
| LCK | IC50: 6.8nM |
| PTK5 | IC50: 7.1nM |
| Fms | IC50: 7.2nM |
| FGFR2 | IC50: 7.3nM |
| EphB1 | IC50: 8.9nM |
| Abl(T315I) | IC50: 9.0nM |
| EphA1 | IC50: 9.1nM |
| ARK5 | IC50: 9.1nM |
| ITK | IC50: 12nM |
| ALK2 | IC50: 13nM |
| CDK7 | IC50: 14nM |
| BLK | IC50: 14nM |
| AuroraB-INCENP | IC50: 15nM |
| JAK2 | IC50: 17nM |
| EphB2 | IC50: 18nM |
| AuroraA-TPX2 | IC50: 21nM |
| STK16 | IC50: 24nM |
| EphA2 | IC50: 24nM |
| BRK | IC50: 25nM |
| EphB4 | IC50: 27nM |
| TNK2 | IC50: 27nM |
| FGFR1 | IC50: 28nM |
| EphA4 | IC50: 31nM |
| STK33 | IC50: 35nM |
| CLK1 | IC50: 45nM |
| AMPK | IC50: 46nM |
| FES | IC50: 48nM |
| SLK | IC50: 49nM |
| Chk2 | IC50: 50nM |
| TYK2 | IC50: 54nM |
| BTK | IC50: 55nM |
| FAK2 | IC50: 55nM |
| c-Kit | IC50: 58nM |
| VEGFR2 | IC50: 60nM |
| FGFR3 | IC50: 65nM |
| ALK5 | IC50: 78nM |
| MAP3K9 | IC50: 80nM |
| CLK3 | IC50: 88nM |
| JAK1 | IC50: 93nM |
| In vitro | DMSO | 101 mg/mL (200.14 mM) | |
| Water | <1 mg/mL (<1 mM) | ||
| Ethanol | <1 mg/mL (<1 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.82 mL | 99.09 mL | 198.18 mL |
| 0.5 mM | 3.96 mL | 19.82 mL | 39.64 mL |
| 1 mM | 1.98 mL | 9.91 mL | 19.82 mL |
| 5 mM | 0.4 mL | 1.98 mL | 3.96 mL |
*The above data is based on the productmolecular weight 504.6. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Technical Details
| Catalog Num | A11067 |
|---|---|
| Actions | Inhibitor |
| M. Wt | 504.6 |
| Formula | C28H32N4O3S |
| Solubility | DMSO |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 934541-31-8 |
| Synonyms | TAK901 |
| SMILES | CCS(=O)(=O)C1=CC=CC(=C1)C2=CC(=C(C3=C2C4=CC(=CN=C4N3)C)C)C(=O)NC5CCN(CC5)C |
Product Tags
Product Questions
Product Questions
No Questions
Keywords:buy TAK-901 | TAK-901 Supplier | purchase TAK-901 | TAK-901 cost | TAK-901 manufacturer | order TAK-901 | TAK-901 distributor | buy 934541-31-8| 934541-31-8 Supplier | purchase 934541-31-8 | 934541-31-8 cost | 934541-31-8 manufacturer | order 934541-31-8 | 934541-31-8 distributor
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: [email protected]
Not your Region? View all Distributors
Adooq Quality Guarantee
We promise all products perform as described.