Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | XEN445 is a potent and selective EL inhibitor(IC50=0.237 uM), that showed good ADME and PK properties, and demonstrated in vivo efficacy in raising plasma HDLc concentrations in mice. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13150 |
|---|---|
| Formula | C18H17F3N2O3 |
| Molecular Weight | 366.33 |
| CAS Number | 1515856-92-4 |
| SMILES | C1CN(CC1OCC2=CC=CC=N2)C3=C(C=C(C=C3)C(F)(F)F)C(=O)O |
| Synonyms | XEN-445, XEN 445 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (215.65 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 34 mg/mL (92.81 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.3 mL | 136.49 mL | 272.98 mL |
| 0.5 mM | 5.46 mL | 27.3 mL | 54.6 mL |
| 1 mM | 2.73 mL | 13.65 mL | 27.3 mL |
| 5 mM | 0.55 mL | 2.73 mL | 5.46 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
