Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BGJ398 is a potent and selective inhibitor with potential antiangiogenic and antineoplastic activities of fibroblast growth factor receptor (FGFR) tyrosine kinases 1, 2, 3 and 4 (with IC50 values of 0.9, 1.4, 1.0 and 60 nM for FGFR1, FGFR2, FGFR3, and FGFR4 respectively). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11159 |
|---|---|
| Formula | C26H31Cl2N7O3 |
| Molecular Weight | 560.48 |
| CAS Number | 872511-34-7 |
| SMILES | CCN1CCN(CC1)C2=CC=C(C=C2)NC3=CC(=NC=N3)N(C)C(=O)NC4=C(C(=CC(=C4Cl)OC)OC)Cl |
| Synonyms | BGJ-398 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 1 mg/mL (1.78 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 1%CMC-Na | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.84 mL | 89.21 mL | 178.42 mL |
| 0.5 mM | 3.57 mL | 17.84 mL | 35.68 mL |
| 1 mM | 1.78 mL | 8.92 mL | 17.84 mL |
| 5 mM | 0.36 mL | 1.78 mL | 3.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
