Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PF-04929113 (SNX-5422) is orally bioavailable heat shock protein 90 (Hsp90) inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11074 |
|---|---|
| Formula | C25H30F3N5O4 |
| Molecular Weight | 521.5 |
| CAS Number | 908115-27-5 |
| SMILES | CC1(CC2=C(C(=O)C1)C(=NN2C3=CC(=C(C=C3)C(=O)N)NC4CCC(CC4)OC(=O)CN)C(F)(F)F)C |
| Synonyms | PF04929113, SNX5422 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 90 mg/mL (172.57 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (7.66 mM) | ||
| In vivo | 0.5% CMC+0.25% Tween 80 | 23 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.18 mL | 95.88 mL | 191.75 mL |
| 0.5 mM | 3.84 mL | 19.18 mL | 38.35 mL |
| 1 mM | 1.92 mL | 9.59 mL | 19.18 mL |
| 5 mM | 0.38 mL | 1.92 mL | 3.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
